C11H10Cl2N4O2 — CID 11962489
[(1R)-1-(2,4-dichlorophenyl)-2-(triazol-2-yl)ethyl] carbamate (PubChem CID 11962489) has the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichlorophenyl)-2-(triazol-2-yl)ethyl] carbamate.
| Compound Name | [(1R)-1-(2,4-dichlorophenyl)-2-(triazol-2-yl)ethyl] carbamate |
|---|---|
| PubChem CID | 11962489 |
| Molecular Formula | C11H10Cl2N4O2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | [(1R)-1-(2,4-dichlorophenyl)-2-(triazol-2-yl)ethyl] carbamate |
| SMILES | NC(=O)O[C@@H](Cn1nccn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N4O2/c12-7-1-2-8(9(13)5-7)10(19-11(14)18)6-17-15-3-4-16-17/h1-5,10H,6H2,(H2,14,18)/t10-/m0/s1 |
| InChIKey | SEWIQVFKKFNAMP-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |