C10H8Cl4O2 — CID 53231004
[(1S)-2-chloro-1-(2,4-dichlorophenyl)ethyl] 2-chloroacetate (PubChem CID 53231004) has the molecular formula C10H8Cl4O2 and a molecular weight of 301.98 g/mol. Its IUPAC name is [(1S)-2-chloro-1-(2,4-dichlorophenyl)ethyl] 2-chloroacetate.
| Compound Name | [(1S)-2-chloro-1-(2,4-dichlorophenyl)ethyl] 2-chloroacetate |
|---|---|
| PubChem CID | 53231004 |
| Molecular Formula | C10H8Cl4O2 |
| Molecular Weight | 301.98 g/mol |
| Exact Mass | 299.93 |
| IUPAC Name | [(1S)-2-chloro-1-(2,4-dichlorophenyl)ethyl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@H](CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl4O2/c11-4-9(16-10(15)5-12)7-2-1-6(13)3-8(7)14/h1-3,9H,4-5H2/t9-/m1/s1 |
| InChIKey | ZJTMNCUCKUVEQC-SECBINFHSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.98 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|