C10H12Cl3O4P — CID 134934512
[(1R)-2-chloro-1-(2,4-dichlorophenyl)ethyl] dimethyl phosphate (PubChem CID 134934512) has the molecular formula C10H12Cl3O4P and a molecular weight of 333.54 g/mol. Its IUPAC name is [(1R)-2-chloro-1-(2,4-dichlorophenyl)ethyl] dimethyl phosphate.
| Compound Name | [(1R)-2-chloro-1-(2,4-dichlorophenyl)ethyl] dimethyl phosphate |
|---|---|
| PubChem CID | 134934512 |
| Molecular Formula | C10H12Cl3O4P |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | [(1R)-2-chloro-1-(2,4-dichlorophenyl)ethyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)O[C@@H](CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl3O4P/c1-15-18(14,16-2)17-10(6-11)8-4-3-7(12)5-9(8)13/h3-5,10H,6H2,1-2H3/t10-/m0/s1 |
| InChIKey | WPQTUSJHRKQTKU-JTQLQIEISA-N |
| XLogP | 4.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|