methyl (2,4-dichlorophenyl)-methoxymethanesulfinate

C9H10Cl2O3S — CID 10858513

IUPACmethyl (2,4-dichlorophenyl)-methoxymethanesulfinate
SMILESCOC(c1ccc(Cl)cc1Cl)S(=O)OC
InChIInChI=1S/C9H10Cl2O3S/c1-13-9(15(12)14-2)7-4-3-6(10)5-8(7)11/h3-5,9H,1-2H3
InChIKeyLCCWEPGSIRRWHT-UHFFFAOYSA-N
MW269.15 g/mol
LogP2.95
Rot. Bonds4

About methyl (2,4-dichlorophenyl)-methoxymethanesulfinate

methyl (2,4-dichlorophenyl)-methoxymethanesulfinate (PubChem CID 10858513) has the molecular formula C9H10Cl2O3S and a molecular weight of 269.15 g/mol. Its IUPAC name is methyl (2,4-dichlorophenyl)-methoxymethanesulfinate.

Molecular Properties

Compound Namemethyl (2,4-dichlorophenyl)-methoxymethanesulfinate
PubChem CID10858513
Molecular FormulaC9H10Cl2O3S
Molecular Weight269.15 g/mol
Exact Mass267.97
IUPAC Namemethyl (2,4-dichlorophenyl)-methoxymethanesulfinate
SMILESCOC(c1ccc(Cl)cc1Cl)S(=O)OC
InChIInChI=1S/C9H10Cl2O3S/c1-13-9(15(12)14-2)7-4-3-6(10)5-8(7)11/h3-5,9H,1-2H3
InChIKeyLCCWEPGSIRRWHT-UHFFFAOYSA-N
XLogP2.95
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.15
LogP ≤ 52.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2,4-dichlorophenyl)-methoxymethanesulfinate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2,4-dichlorophenyl)-methoxymethanesulfinate?
The IUPAC name of methyl (2,4-dichlorophenyl)-methoxymethanesulfinate (CID 10858513) is methyl (2,4-dichlorophenyl)-methoxymethanesulfinate.
What is the SMILES notation for methyl (2,4-dichlorophenyl)-methoxymethanesulfinate?
The canonical SMILES for methyl (2,4-dichlorophenyl)-methoxymethanesulfinate is COC(c1ccc(Cl)cc1Cl)S(=O)OC.
What is the InChIKey of methyl (2,4-dichlorophenyl)-methoxymethanesulfinate?
The InChIKey is LCCWEPGSIRRWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2O3S/c1-13-9(15(12)14-2)7-4-3-6(10)5-8(7)11/h3-5,9H,1-2H3.
What are the key properties of methyl (2,4-dichlorophenyl)-methoxymethanesulfinate?
methyl (2,4-dichlorophenyl)-methoxymethanesulfinate has a molecular weight of 269.15 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2,4-dichlorophenyl)-methoxymethanesulfinate is sourced from PubChem (CID 10858513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).