C16H15BrCl2O — CID 83068733
5-[bromo-(2,4-dichlorophenyl)methyl]-2-methoxy-1,3-dimethylbenzene (PubChem CID 83068733) has the molecular formula C16H15BrCl2O and a molecular weight of 374.11 g/mol. Its IUPAC name is 5-[bromo-(2,4-dichlorophenyl)methyl]-2-methoxy-1,3-dimethylbenzene.
| Compound Name | 5-[bromo-(2,4-dichlorophenyl)methyl]-2-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 83068733 |
| Molecular Formula | C16H15BrCl2O |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 5-[bromo-(2,4-dichlorophenyl)methyl]-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(C(Br)c2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C16H15BrCl2O/c1-9-6-11(7-10(2)16(9)20-3)15(17)13-5-4-12(18)8-14(13)19/h4-8,15H,1-3H3 |
| InChIKey | RSIJLNIXSZTXGQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|