C15H17BrO2 — CID 83068075
3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methylfuran (PubChem CID 83068075) has the molecular formula C15H17BrO2 and a molecular weight of 309.20 g/mol. Its IUPAC name is 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methylfuran.
| Compound Name | 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methylfuran |
|---|---|
| PubChem CID | 83068075 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methylfuran |
| SMILES | COc1c(C)cc(C(Br)c2ccoc2C)cc1C |
| InChI | InChI=1S/C15H17BrO2/c1-9-7-12(8-10(2)15(9)17-4)14(16)13-5-6-18-11(13)3/h5-8,14H,1-4H3 |
| InChIKey | MEBNQKHRSLDVAP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|