About 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene
1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene (PubChem CID 83046737) has the molecular formula C16H14BrClF2O
and a molecular weight of 375.64 g/mol. Its IUPAC name is 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene |
| PubChem CID | 83046737 |
| Molecular Formula | C16H14BrClF2O |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene |
| SMILES | COc1c(C)cc(C(Br)c2cc(F)c(Cl)cc2F)cc1C |
| InChI | InChI=1S/C16H14BrClF2O/c1-8-4-10(5-9(2)16(8)21-3)15(17)11-6-14(20)12(18)7-13(11)19/h4-7,15H,1-3H3 |
| InChIKey | TVRGYNIGICCZPD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene?
The IUPAC name of 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene (CID 83046737) is 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene.
What is the SMILES notation for 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene?
The canonical SMILES for 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene is COc1c(C)cc(C(Br)c2cc(F)c(Cl)cc2F)cc1C.
What is the InChIKey of 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene?
The InChIKey is TVRGYNIGICCZPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrClF2O/c1-8-4-10(5-9(2)16(8)21-3)15(17)11-6-14(20)12(18)7-13(11)19/h4-7,15H,1-3H3.
What are the key properties of 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene?
1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene has a molecular weight of 375.64 g/mol, XLogP of 5.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-4-chloro-2,5-difluorobenzene is sourced from PubChem (CID 83046737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).