C15H11BrCl2F2O — CID 82773177
1-bromo-5-[chloro-(4-chloro-2,5-difluorophenyl)methyl]-4-methoxy-2-methylbenzene (PubChem CID 82773177) has the molecular formula C15H11BrCl2F2O and a molecular weight of 396.06 g/mol. Its IUPAC name is 1-bromo-5-[chloro-(4-chloro-2,5-difluorophenyl)methyl]-4-methoxy-2-methylbenzene.
| Compound Name | 1-bromo-5-[chloro-(4-chloro-2,5-difluorophenyl)methyl]-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 82773177 |
| Molecular Formula | C15H11BrCl2F2O |
| Molecular Weight | 396.06 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 1-bromo-5-[chloro-(4-chloro-2,5-difluorophenyl)methyl]-4-methoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(Br)cc1C(Cl)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C15H11BrCl2F2O/c1-7-3-14(21-2)9(4-10(7)16)15(18)8-5-13(20)11(17)6-12(8)19/h3-6,15H,1-2H3 |
| InChIKey | IFMJBQIZPUFOGE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.06 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|