C13H10BrCl3OS — CID 114021669
3-[(5-bromo-2-methoxy-4-methylphenyl)-chloromethyl]-2,5-dichlorothiophene (PubChem CID 114021669) has the molecular formula C13H10BrCl3OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxy-4-methylphenyl)-chloromethyl]-2,5-dichlorothiophene.
| Compound Name | 3-[(5-bromo-2-methoxy-4-methylphenyl)-chloromethyl]-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 114021669 |
| Molecular Formula | C13H10BrCl3OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 3-[(5-bromo-2-methoxy-4-methylphenyl)-chloromethyl]-2,5-dichlorothiophene |
| SMILES | COc1cc(C)c(Br)cc1C(Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H10BrCl3OS/c1-6-3-10(18-2)7(4-9(6)14)12(16)8-5-11(15)19-13(8)17/h3-5,12H,1-2H3 |
| InChIKey | AMGPMXZQIDZRCU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|