C14H12BrCl3OS — CID 107964976
3-[(5-bromo-2-methoxy-3,6-dimethylphenyl)-chloromethyl]-2,5-dichlorothiophene (PubChem CID 107964976) has the molecular formula C14H12BrCl3OS and a molecular weight of 414.58 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxy-3,6-dimethylphenyl)-chloromethyl]-2,5-dichlorothiophene.
| Compound Name | 3-[(5-bromo-2-methoxy-3,6-dimethylphenyl)-chloromethyl]-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 107964976 |
| Molecular Formula | C14H12BrCl3OS |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 411.89 |
| IUPAC Name | 3-[(5-bromo-2-methoxy-3,6-dimethylphenyl)-chloromethyl]-2,5-dichlorothiophene |
| SMILES | COc1c(C)cc(Br)c(C)c1C(Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H12BrCl3OS/c1-6-4-9(15)7(2)11(13(6)19-3)12(17)8-5-10(16)20-14(8)18/h4-5,12H,1-3H3 |
| InChIKey | BORPKJOPCUWSSO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|