About 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene
1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene (PubChem CID 114375192) has the molecular formula C16H14Br4O
and a molecular weight of 541.90 g/mol. Its IUPAC name is 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene |
| PubChem CID | 114375192 |
| Molecular Formula | C16H14Br4O |
| Molecular Weight | 541.90 g/mol |
| Exact Mass | 537.78 |
| IUPAC Name | 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene |
| SMILES | COc1c(C)cc(Br)c(C)c1C(Br)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H14Br4O/c1-8-6-13(19)9(2)14(16(8)21-3)15(20)11-7-10(17)4-5-12(11)18/h4-7,15H,1-3H3 |
| InChIKey | XBMNKPMIOBHNQG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.90 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene?
The IUPAC name of 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene (CID 114375192) is 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene.
What is the SMILES notation for 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene?
The canonical SMILES for 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene is COc1c(C)cc(Br)c(C)c1C(Br)c1cc(Br)ccc1Br.
What is the InChIKey of 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene?
The InChIKey is XBMNKPMIOBHNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Br4O/c1-8-6-13(19)9(2)14(16(8)21-3)15(20)11-7-10(17)4-5-12(11)18/h4-7,15H,1-3H3.
What are the key properties of 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene?
1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene has a molecular weight of 541.90 g/mol, XLogP of 7.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene is sourced from PubChem (CID 114375192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).