C16H14Br4O — CID 114375192
1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene (PubChem CID 114375192) has the molecular formula C16H14Br4O and a molecular weight of 541.90 g/mol. Its IUPAC name is 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene.
| Compound Name | 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 114375192 |
| Molecular Formula | C16H14Br4O |
| Molecular Weight | 541.90 g/mol |
| Exact Mass | 537.78 |
| IUPAC Name | 1-bromo-3-[bromo-(2,5-dibromophenyl)methyl]-4-methoxy-2,5-dimethylbenzene |
| SMILES | COc1c(C)cc(Br)c(C)c1C(Br)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H14Br4O/c1-8-6-13(19)9(2)14(16(8)21-3)15(20)11-7-10(17)4-5-12(11)18/h4-7,15H,1-3H3 |
| InChIKey | XBMNKPMIOBHNQG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.90 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|