C16H14Br2ClFO — CID 107959131
1-bromo-3-[(3-bromo-4-fluorophenyl)-chloromethyl]-4-methoxy-2,5-dimethylbenzene (PubChem CID 107959131) has the molecular formula C16H14Br2ClFO and a molecular weight of 436.55 g/mol. Its IUPAC name is 1-bromo-3-[(3-bromo-4-fluorophenyl)-chloromethyl]-4-methoxy-2,5-dimethylbenzene.
| Compound Name | 1-bromo-3-[(3-bromo-4-fluorophenyl)-chloromethyl]-4-methoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 107959131 |
| Molecular Formula | C16H14Br2ClFO |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 433.91 |
| IUPAC Name | 1-bromo-3-[(3-bromo-4-fluorophenyl)-chloromethyl]-4-methoxy-2,5-dimethylbenzene |
| SMILES | COc1c(C)cc(Br)c(C)c1C(Cl)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2ClFO/c1-8-6-11(17)9(2)14(16(8)21-3)15(19)10-4-5-13(20)12(18)7-10/h4-7,15H,1-3H3 |
| InChIKey | WVEQAYYYRPTTPS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|