C16H16BrClINO — CID 103220560
(5-bromo-2-methoxy-3,6-dimethylphenyl)-(3-chloro-4-iodophenyl)methanamine (PubChem CID 103220560) has the molecular formula C16H16BrClINO and a molecular weight of 480.57 g/mol. Its IUPAC name is (5-bromo-2-methoxy-3,6-dimethylphenyl)-(3-chloro-4-iodophenyl)methanamine.
| Compound Name | (5-bromo-2-methoxy-3,6-dimethylphenyl)-(3-chloro-4-iodophenyl)methanamine |
|---|---|
| PubChem CID | 103220560 |
| Molecular Formula | C16H16BrClINO |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | (5-bromo-2-methoxy-3,6-dimethylphenyl)-(3-chloro-4-iodophenyl)methanamine |
| SMILES | COc1c(C)cc(Br)c(C)c1C(N)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C16H16BrClINO/c1-8-6-11(17)9(2)14(16(8)21-3)15(20)10-4-5-13(19)12(18)7-10/h4-7,15H,20H2,1-3H3 |
| InChIKey | YQRNXWVVECUQGV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|