C11H7Br2ClINS — CID 103220480
(3-chloro-4-iodophenyl)-(4,5-dibromothiophen-2-yl)methanamine (PubChem CID 103220480) has the molecular formula C11H7Br2ClINS and a molecular weight of 507.42 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(4,5-dibromothiophen-2-yl)methanamine.
| Compound Name | (3-chloro-4-iodophenyl)-(4,5-dibromothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 103220480 |
| Molecular Formula | C11H7Br2ClINS |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 504.74 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(4,5-dibromothiophen-2-yl)methanamine |
| SMILES | NC(c1ccc(I)c(Cl)c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H7Br2ClINS/c12-6-4-9(17-11(6)13)10(16)5-1-2-8(15)7(14)3-5/h1-4,10H,16H2 |
| InChIKey | KDHBQACEDZDHCN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|