C13H11Cl3O2S — CID 63436479
2,5-dichloro-3-[chloro-(3,5-dimethoxyphenyl)methyl]thiophene (PubChem CID 63436479) has the molecular formula C13H11Cl3O2S and a molecular weight of 337.66 g/mol. Its IUPAC name is 2,5-dichloro-3-[chloro-(3,5-dimethoxyphenyl)methyl]thiophene.
| Compound Name | 2,5-dichloro-3-[chloro-(3,5-dimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63436479 |
| Molecular Formula | C13H11Cl3O2S |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2,5-dichloro-3-[chloro-(3,5-dimethoxyphenyl)methyl]thiophene |
| SMILES | COc1cc(OC)cc(C(Cl)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C13H11Cl3O2S/c1-17-8-3-7(4-9(5-8)18-2)12(15)10-6-11(14)19-13(10)16/h3-6,12H,1-2H3 |
| InChIKey | ZGZGLKBYCFDLQF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|