C12H9Cl3S — CID 63436429
2,5-dichloro-3-[chloro-(4-methylphenyl)methyl]thiophene (PubChem CID 63436429) has the molecular formula C12H9Cl3S and a molecular weight of 291.63 g/mol. Its IUPAC name is 2,5-dichloro-3-[chloro-(4-methylphenyl)methyl]thiophene.
| Compound Name | 2,5-dichloro-3-[chloro-(4-methylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63436429 |
| Molecular Formula | C12H9Cl3S |
| Molecular Weight | 291.63 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | 2,5-dichloro-3-[chloro-(4-methylphenyl)methyl]thiophene |
| SMILES | Cc1ccc(C(Cl)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C12H9Cl3S/c1-7-2-4-8(5-3-7)11(14)9-6-10(13)16-12(9)15/h2-6,11H,1H3 |
| InChIKey | CKNAOGGDMVFHEU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|