C15H12BrF3O2 — CID 103304368
1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103304368) has the molecular formula C15H12BrF3O2 and a molecular weight of 361.16 g/mol. Its IUPAC name is 1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103304368 |
| Molecular Formula | C15H12BrF3O2 |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | COc1cc(OC)cc(C(Br)c2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C15H12BrF3O2/c1-20-9-3-8(4-10(5-9)21-2)15(16)11-6-13(18)14(19)7-12(11)17/h3-7,15H,1-2H3 |
| InChIKey | DRERYMJPKNWFPC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|