C17H19BrO2 — CID 63438910
1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4-dimethylbenzene (PubChem CID 63438910) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4-dimethylbenzene.
| Compound Name | 1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 63438910 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-[bromo-(3,5-dimethoxyphenyl)methyl]-2,4-dimethylbenzene |
| SMILES | COc1cc(OC)cc(C(Br)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H19BrO2/c1-11-5-6-16(12(2)7-11)17(18)13-8-14(19-3)10-15(9-13)20-4/h5-10,17H,1-4H3 |
| InChIKey | PDGRDSREUDRJKP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|