C19H16Br2 — CID 115354342
2-bromo-6-[bromo-(2,4-dimethylphenyl)methyl]naphthalene (PubChem CID 115354342) has the molecular formula C19H16Br2 and a molecular weight of 404.15 g/mol. Its IUPAC name is 2-bromo-6-[bromo-(2,4-dimethylphenyl)methyl]naphthalene.
| Compound Name | 2-bromo-6-[bromo-(2,4-dimethylphenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 115354342 |
| Molecular Formula | C19H16Br2 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 2-bromo-6-[bromo-(2,4-dimethylphenyl)methyl]naphthalene |
| SMILES | Cc1ccc(C(Br)c2ccc3cc(Br)ccc3c2)c(C)c1 |
| InChI | InChI=1S/C19H16Br2/c1-12-3-8-18(13(2)9-12)19(21)16-5-4-15-11-17(20)7-6-14(15)10-16/h3-11,19H,1-2H3 |
| InChIKey | YNOQRAVQQKQCMB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|