C16H14BrF3O — CID 103304174
1-[bromo-(3-propan-2-yloxyphenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103304174) has the molecular formula C16H14BrF3O and a molecular weight of 359.19 g/mol. Its IUPAC name is 1-[bromo-(3-propan-2-yloxyphenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[bromo-(3-propan-2-yloxyphenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103304174 |
| Molecular Formula | C16H14BrF3O |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-[bromo-(3-propan-2-yloxyphenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | CC(C)Oc1cccc(C(Br)c2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C16H14BrF3O/c1-9(2)21-11-5-3-4-10(6-11)16(17)12-7-14(19)15(20)8-13(12)18/h3-9,16H,1-2H3 |
| InChIKey | JBWRMSCVCJYEDE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|