C16H14Cl2F2O — CID 107477257
1-chloro-2-[chloro-(3-propan-2-yloxyphenyl)methyl]-4,5-difluorobenzene (PubChem CID 107477257) has the molecular formula C16H14Cl2F2O and a molecular weight of 331.19 g/mol. Its IUPAC name is 1-chloro-2-[chloro-(3-propan-2-yloxyphenyl)methyl]-4,5-difluorobenzene.
| Compound Name | 1-chloro-2-[chloro-(3-propan-2-yloxyphenyl)methyl]-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477257 |
| Molecular Formula | C16H14Cl2F2O |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-chloro-2-[chloro-(3-propan-2-yloxyphenyl)methyl]-4,5-difluorobenzene |
| SMILES | CC(C)Oc1cccc(C(Cl)c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2F2O/c1-9(2)21-11-5-3-4-10(6-11)16(18)12-7-14(19)15(20)8-13(12)17/h3-9,16H,1-2H3 |
| InChIKey | WZGAYYWDSXAGEB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|