C14H13Br3OS — CID 80534567
2,3-dibromo-5-[bromo-(3-propan-2-yloxyphenyl)methyl]thiophene (PubChem CID 80534567) has the molecular formula C14H13Br3OS and a molecular weight of 469.04 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo-(3-propan-2-yloxyphenyl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo-(3-propan-2-yloxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 80534567 |
| Molecular Formula | C14H13Br3OS |
| Molecular Weight | 469.04 g/mol |
| Exact Mass | 465.82 |
| IUPAC Name | 2,3-dibromo-5-[bromo-(3-propan-2-yloxyphenyl)methyl]thiophene |
| SMILES | CC(C)Oc1cccc(C(Br)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C14H13Br3OS/c1-8(2)18-10-5-3-4-9(6-10)13(16)12-7-11(15)14(17)19-12/h3-8,13H,1-2H3 |
| InChIKey | ZRQNLFQMMYXKDO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|