C10H12Cl2NO3- — CID 163640824
N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-N-oxidohydroxylamine (PubChem CID 163640824) has the molecular formula C10H12Cl2NO3- and a molecular weight of 265.12 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-N-oxidohydroxylamine.
| Compound Name | N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163640824 |
| Molecular Formula | C10H12Cl2NO3- |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-N-oxidohydroxylamine |
| SMILES | COC(c1ccc(Cl)cc1Cl)C(C)N([O-])O |
| InChI | InChI=1S/C10H12Cl2NO3/c1-6(13(14)15)10(16-2)8-4-3-7(11)5-9(8)12/h3-6,10,14H,1-2H3/q-1 |
| InChIKey | OCLWRXCNTCMIGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|