C15H19Cl2F2N3O2 — CID 162609725
(2E)-3-amino-2-(aminomethylidene)-N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-4,4-difluorobutanamide (PubChem CID 162609725) has the molecular formula C15H19Cl2F2N3O2 and a molecular weight of 382.24 g/mol. Its IUPAC name is (2E)-3-amino-2-(aminomethylidene)-N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-4,4-difluorobutanamide.
| Compound Name | (2E)-3-amino-2-(aminomethylidene)-N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-4,4-difluorobutanamide |
|---|---|
| PubChem CID | 162609725 |
| Molecular Formula | C15H19Cl2F2N3O2 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (2E)-3-amino-2-(aminomethylidene)-N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]-4,4-difluorobutanamide |
| SMILES | COC(c1ccc(Cl)cc1Cl)C(C)NC(=O)/C(=C/N)C(N)C(F)F |
| InChI | InChI=1S/C15H19Cl2F2N3O2/c1-7(22-15(23)10(6-20)12(21)14(18)19)13(24-2)9-4-3-8(16)5-11(9)17/h3-7,12-14H,20-21H2,1-2H3,(H,22,23)/b10-6+ |
| InChIKey | HLBQMMLZTXRJNR-UXBLZVDNSA-N |
| XLogP | 2.62 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|