C26H39Cl2F2N3O3 — CID 159266149
N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]decan-1-amine;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid (PubChem CID 159266149) has the molecular formula C26H39Cl2F2N3O3 and a molecular weight of 550.52 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]decan-1-amine;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]decan-1-amine;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 159266149 |
| Molecular Formula | C26H39Cl2F2N3O3 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]decan-1-amine;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
| SMILES | CCCCCCCCCCNC(C)C(OC)c1ccc(Cl)cc1Cl.Cn1cc(C(=O)O)c(C(F)F)n1 |
| InChI | InChI=1S/C20H33Cl2NO.C6H6F2N2O2/c1-4-5-6-7-8-9-10-11-14-23-16(2)20(24-3)18-13-12-17(21)15-19(18)22;1-10-2-3(6(11)12)4(9-10)5(7)8/h12-13,15-16,20,23H,4-11,14H2,1-3H3;2,5H,1H3,(H,11,12) |
| InChIKey | KXCYBRLRQNJYKO-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|