C18H22Cl2F2N3O3- — CID 162194977
1-(2,4-dichlorophenyl)propan-2-yl-propan-2-yloxyazanide;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid (PubChem CID 162194977) has the molecular formula C18H22Cl2F2N3O3- and a molecular weight of 437.29 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)propan-2-yl-propan-2-yloxyazanide;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 1-(2,4-dichlorophenyl)propan-2-yl-propan-2-yloxyazanide;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 162194977 |
| Molecular Formula | C18H22Cl2F2N3O3- |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)propan-2-yl-propan-2-yloxyazanide;3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
| SMILES | CC(Cc1ccc(Cl)cc1Cl)[N-]OC(C)C.Cn1cc(C(=O)O)c(C(F)F)n1 |
| InChI | InChI=1S/C12H16Cl2NO.C6H6F2N2O2/c1-8(2)16-15-9(3)6-10-4-5-11(13)7-12(10)14;1-10-2-3(6(11)12)4(9-10)5(7)8/h4-5,7-9H,6H2,1-3H3;2,5H,1H3,(H,11,12)/q-1; |
| InChIKey | ZQUXTHHVDBBOJN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|