About [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate
[3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate (PubChem CID 67424789) has the molecular formula C16H17Cl2F2N3O3
and a molecular weight of 408.23 g/mol. Its IUPAC name is [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate.
Molecular Properties
| Compound Name | [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate |
| PubChem CID | 67424789 |
| Molecular Formula | C16H17Cl2F2N3O3 |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate |
| SMILES | COC(c1ccc(Cl)cc1Cl)C(C)NC(=O)Oc1cn(C)nc1C(F)F |
| InChI | InChI=1S/C16H17Cl2F2N3O3/c1-8(14(25-3)10-5-4-9(17)6-11(10)18)21-16(24)26-12-7-23(2)22-13(12)15(19)20/h4-8,14-15H,1-3H3,(H,21,24) |
| InChIKey | ZXZAFMLFGBGIPT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate?
The IUPAC name of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate (CID 67424789) is [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate.
What is the SMILES notation for [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate?
The canonical SMILES for [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate is COC(c1ccc(Cl)cc1Cl)C(C)NC(=O)Oc1cn(C)nc1C(F)F.
What is the InChIKey of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate?
The InChIKey is ZXZAFMLFGBGIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2F2N3O3/c1-8(14(25-3)10-5-4-9(17)6-11(10)18)21-16(24)26-12-7-23(2)22-13(12)15(19)20/h4-8,14-15H,1-3H3,(H,21,24).
What are the key properties of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate?
[3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate has a molecular weight of 408.23 g/mol, XLogP of 4.53, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[1-(2,4-dichlorophenyl)-1-methoxypropan-2-yl]carbamate is sourced from PubChem (CID 67424789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).