C16H16Cl2F3N3O2 — CID 54589414
N-[1-(2,4-dichlorophenyl)-3-fluoropropan-2-yl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 54589414) has the molecular formula C16H16Cl2F3N3O2 and a molecular weight of 410.22 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)-3-fluoropropan-2-yl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)-3-fluoropropan-2-yl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 54589414 |
| Molecular Formula | C16H16Cl2F3N3O2 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)-3-fluoropropan-2-yl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | CON(C(=O)c1cn(C)nc1C(F)F)C(CF)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2F3N3O2/c1-23-8-12(14(22-23)15(20)21)16(25)24(26-2)11(7-19)5-9-3-4-10(17)6-13(9)18/h3-4,6,8,11,15H,5,7H2,1-2H3 |
| InChIKey | WJCBVVOBZJWVCO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|