C16H19F2N3O2 — CID 86580821
3-(difluoromethyl)-N-methoxy-1-methyl-N-(1-phenylpropan-2-yl)pyrazole-4-carboxamide (PubChem CID 86580821) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-methoxy-1-methyl-N-(1-phenylpropan-2-yl)pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-N-methoxy-1-methyl-N-(1-phenylpropan-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86580821 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-(difluoromethyl)-N-methoxy-1-methyl-N-(1-phenylpropan-2-yl)pyrazole-4-carboxamide |
| SMILES | CON(C(=O)c1cn(C)nc1C(F)F)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-11(9-12-7-5-4-6-8-12)21(23-3)16(22)13-10-20(2)19-14(13)15(17)18/h4-8,10-11,15H,9H2,1-3H3 |
| InChIKey | XKDRDLNBSRCAGQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|