C12H17F2N3O4 — CID 87514130
2-[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]-methoxyamino]propyl acetate (PubChem CID 87514130) has the molecular formula C12H17F2N3O4 and a molecular weight of 305.28 g/mol. Its IUPAC name is 2-[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]-methoxyamino]propyl acetate.
| Compound Name | 2-[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]-methoxyamino]propyl acetate |
|---|---|
| PubChem CID | 87514130 |
| Molecular Formula | C12H17F2N3O4 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]-methoxyamino]propyl acetate |
| SMILES | CON(C(=O)c1cn(C)nc1C(F)F)C(C)COC(C)=O |
| InChI | InChI=1S/C12H17F2N3O4/c1-7(6-21-8(2)18)17(20-4)12(19)9-5-16(3)15-10(9)11(13)14/h5,7,11H,6H2,1-4H3 |
| InChIKey | BRYRPCHGYAHRPS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|