C21H29F2N3O2 — CID 58443671
N-[3-(4-tert-butylphenyl)-2-methylpropyl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 58443671) has the molecular formula C21H29F2N3O2 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[3-(4-tert-butylphenyl)-2-methylpropyl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[3-(4-tert-butylphenyl)-2-methylpropyl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 58443671 |
| Molecular Formula | C21H29F2N3O2 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[3-(4-tert-butylphenyl)-2-methylpropyl]-3-(difluoromethyl)-N-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | CON(CC(C)Cc1ccc(C(C)(C)C)cc1)C(=O)c1cn(C)nc1C(F)F |
| InChI | InChI=1S/C21H29F2N3O2/c1-14(11-15-7-9-16(10-8-15)21(2,3)4)12-26(28-6)20(27)17-13-25(5)24-18(17)19(22)23/h7-10,13-14,19H,11-12H2,1-6H3 |
| InChIKey | YQYRDWXSMUPBDT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|