About [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate
[3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate (PubChem CID 66878522) has the molecular formula C18H12Cl2F3N3O2
and a molecular weight of 430.21 g/mol. Its IUPAC name is [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate.
Molecular Properties
| Compound Name | [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate |
| PubChem CID | 66878522 |
| Molecular Formula | C18H12Cl2F3N3O2 |
| Molecular Weight | 430.21 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate |
| SMILES | Cn1cc(OC(=O)Nc2ccc(F)cc2-c2ccc(Cl)c(Cl)c2)c(C(F)F)n1 |
| InChI | InChI=1S/C18H12Cl2F3N3O2/c1-26-8-15(16(25-26)17(22)23)28-18(27)24-14-5-3-10(21)7-11(14)9-2-4-12(19)13(20)6-9/h2-8,17H,1H3,(H,24,27) |
| InChIKey | JQJPNQBVBLREDB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.21 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate?
The IUPAC name of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate (CID 66878522) is [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate.
What is the SMILES notation for [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate?
The canonical SMILES for [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate is Cn1cc(OC(=O)Nc2ccc(F)cc2-c2ccc(Cl)c(Cl)c2)c(C(F)F)n1.
What is the InChIKey of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate?
The InChIKey is JQJPNQBVBLREDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2F3N3O2/c1-26-8-15(16(25-26)17(22)23)28-18(27)24-14-5-3-10(21)7-11(14)9-2-4-12(19)13(20)6-9/h2-8,17H,1H3,(H,24,27).
What are the key properties of [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate?
[3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate has a molecular weight of 430.21 g/mol, XLogP of 6.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(difluoromethyl)-1-methylpyrazol-4-yl] N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]carbamate is sourced from PubChem (CID 66878522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).