C10H14ClN3O4S3 — CID 173445874
carbamothioic S-acid;O-[1-(5-chlorothiophen-2-yl)-2-nitroethyl] N,N-dimethylcarbamothioate (PubChem CID 173445874) has the molecular formula C10H14ClN3O4S3 and a molecular weight of 371.89 g/mol. Its IUPAC name is carbamothioic S-acid;O-[1-(5-chlorothiophen-2-yl)-2-nitroethyl] N,N-dimethylcarbamothioate.
| Compound Name | carbamothioic S-acid;O-[1-(5-chlorothiophen-2-yl)-2-nitroethyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 173445874 |
| Molecular Formula | C10H14ClN3O4S3 |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | carbamothioic S-acid;O-[1-(5-chlorothiophen-2-yl)-2-nitroethyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)OC(C[N+](=O)[O-])c1ccc(Cl)s1.NC(=O)S |
| InChI | InChI=1S/C9H11ClN2O3S2.CH3NOS/c1-11(2)9(16)15-6(5-12(13)14)7-3-4-8(10)17-7;2-1(3)4/h3-4,6H,5H2,1-2H3;(H3,2,3,4) |
| InChIKey | SNYIPQUOBOJOCS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|