C10H12ClN3O2S2 — CID 54954733
N-(2-amino-2-sulfanylideneethyl)-N'-[1-(5-chlorothiophen-2-yl)ethyl]oxamide (PubChem CID 54954733) has the molecular formula C10H12ClN3O2S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-[1-(5-chlorothiophen-2-yl)ethyl]oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-[1-(5-chlorothiophen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 54954733 |
| Molecular Formula | C10H12ClN3O2S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-[1-(5-chlorothiophen-2-yl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)NCC(N)=S)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H12ClN3O2S2/c1-5(6-2-3-7(11)18-6)14-10(16)9(15)13-4-8(12)17/h2-3,5H,4H2,1H3,(H2,12,17)(H,13,15)(H,14,16) |
| InChIKey | FGUDYEVESVEECA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|