C11H17ClN2S2 — CID 115579585
1-butyl-3-[1-(5-chlorothiophen-2-yl)ethyl]thiourea (PubChem CID 115579585) has the molecular formula C11H17ClN2S2 and a molecular weight of 276.86 g/mol. Its IUPAC name is 1-butyl-3-[1-(5-chlorothiophen-2-yl)ethyl]thiourea.
| Compound Name | 1-butyl-3-[1-(5-chlorothiophen-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 115579585 |
| Molecular Formula | C11H17ClN2S2 |
| Molecular Weight | 276.86 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-butyl-3-[1-(5-chlorothiophen-2-yl)ethyl]thiourea |
| SMILES | CCCCNC(=S)NC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H17ClN2S2/c1-3-4-7-13-11(15)14-8(2)9-5-6-10(12)16-9/h5-6,8H,3-4,7H2,1-2H3,(H2,13,14,15) |
| InChIKey | VVGWHIPNVFAGSB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|