C10H17N3S2 — CID 115616247
1-butyl-3-[1-(1,3-thiazol-2-yl)ethyl]thiourea (PubChem CID 115616247) has the molecular formula C10H17N3S2 and a molecular weight of 243.40 g/mol. Its IUPAC name is 1-butyl-3-[1-(1,3-thiazol-2-yl)ethyl]thiourea.
| Compound Name | 1-butyl-3-[1-(1,3-thiazol-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 115616247 |
| Molecular Formula | C10H17N3S2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-butyl-3-[1-(1,3-thiazol-2-yl)ethyl]thiourea |
| SMILES | CCCCNC(=S)NC(C)c1nccs1 |
| InChI | InChI=1S/C10H17N3S2/c1-3-4-5-12-10(14)13-8(2)9-11-6-7-15-9/h6-8H,3-5H2,1-2H3,(H2,12,13,14) |
| InChIKey | YJPGXULAMPSFQT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|