C8H14N2S — CID 46785149
N-[1-(1,3-thiazol-2-yl)ethyl]propan-1-amine (PubChem CID 46785149) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(1,3-thiazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 46785149 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1nccs1 |
| InChI | InChI=1S/C8H14N2S/c1-3-4-9-7(2)8-10-5-6-11-8/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | QZJNUSDLUALGRS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |