C11H14N2S2 — CID 61347143
N-[1,3-thiazol-2-yl(thiophen-2-yl)methyl]propan-1-amine (PubChem CID 61347143) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is N-[1,3-thiazol-2-yl(thiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[1,3-thiazol-2-yl(thiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 61347143 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-[1,3-thiazol-2-yl(thiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccs1)c1nccs1 |
| InChI | InChI=1S/C11H14N2S2/c1-2-5-12-10(9-4-3-7-14-9)11-13-6-8-15-11/h3-4,6-8,10,12H,2,5H2,1H3 |
| InChIKey | RWOZTLLBZWYUHL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |