C9H12N2O3S2 — CID 88792668
O-(2-nitro-1-thiophen-2-ylethyl) N,N-dimethylcarbamothioate (PubChem CID 88792668) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is O-(2-nitro-1-thiophen-2-ylethyl) N,N-dimethylcarbamothioate.
| Compound Name | O-(2-nitro-1-thiophen-2-ylethyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 88792668 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | O-(2-nitro-1-thiophen-2-ylethyl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)OC(C[N+](=O)[O-])c1cccs1 |
| InChI | InChI=1S/C9H12N2O3S2/c1-10(2)9(15)14-7(6-11(12)13)8-4-3-5-16-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | PNCHFNOYXXBVJD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|