C12H17NO4S — CID 134999487
(2R)-2-methyl-6-[(1S)-2-nitro-1-thiophen-2-ylethoxy]oxane (PubChem CID 134999487) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2R)-2-methyl-6-[(1S)-2-nitro-1-thiophen-2-ylethoxy]oxane.
| Compound Name | (2R)-2-methyl-6-[(1S)-2-nitro-1-thiophen-2-ylethoxy]oxane |
|---|---|
| PubChem CID | 134999487 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2R)-2-methyl-6-[(1S)-2-nitro-1-thiophen-2-ylethoxy]oxane |
| SMILES | C[C@@H]1CCCC(O[C@@H](C[N+](=O)[O-])c2cccs2)O1 |
| InChI | InChI=1S/C12H17NO4S/c1-9-4-2-6-12(16-9)17-10(8-13(14)15)11-5-3-7-18-11/h3,5,7,9-10,12H,2,4,6,8H2,1H3/t9-,10+,12?/m1/s1 |
| InChIKey | XHGMGPNPKYKDOB-WFCWDVHWSA-N |
| XLogP | 3.00 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|