C16H22O6S — CID 12987269
dimethyl 2-[(S)-[(2R,6S)-6-methyloxan-2-yl]oxy-thiophen-2-ylmethyl]propanedioate (PubChem CID 12987269) has the molecular formula C16H22O6S and a molecular weight of 342.41 g/mol. Its IUPAC name is dimethyl 2-[(S)-[(2R,6S)-6-methyloxan-2-yl]oxy-thiophen-2-ylmethyl]propanedioate.
| Compound Name | dimethyl 2-[(S)-[(2R,6S)-6-methyloxan-2-yl]oxy-thiophen-2-ylmethyl]propanedioate |
|---|---|
| PubChem CID | 12987269 |
| Molecular Formula | C16H22O6S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | dimethyl 2-[(S)-[(2R,6S)-6-methyloxan-2-yl]oxy-thiophen-2-ylmethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](O[C@@H]1CCC[C@H](C)O1)c1cccs1 |
| InChI | InChI=1S/C16H22O6S/c1-10-6-4-8-12(21-10)22-14(11-7-5-9-23-11)13(15(17)19-2)16(18)20-3/h5,7,9-10,12-14H,4,6,8H2,1-3H3/t10-,12+,14+/m0/s1 |
| InChIKey | KIMQSRSWWUSGBI-ZKYQVNSYSA-N |
| XLogP | 2.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|