About methanol;2-methoxy-6-methyloxane
methanol;2-methoxy-6-methyloxane (PubChem CID 143625427) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is methanol;2-methoxy-6-methyloxane.
Molecular Properties
| Compound Name | methanol;2-methoxy-6-methyloxane |
| PubChem CID | 143625427 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | methanol;2-methoxy-6-methyloxane |
| SMILES | CO.COC1CCCC(C)O1 |
| InChI | InChI=1S/C7H14O2.CH4O/c1-6-4-3-5-7(8-2)9-6;1-2/h6-7H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | QZPCDOQMDCEKNH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;2-methoxy-6-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methoxy-6-methyloxane?
The IUPAC name of methanol;2-methoxy-6-methyloxane (CID 143625427) is methanol;2-methoxy-6-methyloxane.
What is the SMILES notation for methanol;2-methoxy-6-methyloxane?
The canonical SMILES for methanol;2-methoxy-6-methyloxane is CO.COC1CCCC(C)O1.
What is the InChIKey of methanol;2-methoxy-6-methyloxane?
The InChIKey is QZPCDOQMDCEKNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.CH4O/c1-6-4-3-5-7(8-2)9-6;1-2/h6-7H,3-5H2,1-2H3;2H,1H3.
What are the key properties of methanol;2-methoxy-6-methyloxane?
methanol;2-methoxy-6-methyloxane has a molecular weight of 162.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methoxy-6-methyloxane is sourced from PubChem (CID 143625427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).