About 2-decoxy-6-methyloxane
2-decoxy-6-methyloxane (PubChem CID 160930984) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-decoxy-6-methyloxane.
Molecular Properties
| Compound Name | 2-decoxy-6-methyloxane |
| PubChem CID | 160930984 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2-decoxy-6-methyloxane |
| SMILES | CCCCCCCCCCOC1CCCC(C)O1 |
| InChI | InChI=1S/C16H32O2/c1-3-4-5-6-7-8-9-10-14-17-16-13-11-12-15(2)18-16/h15-16H,3-14H2,1-2H3 |
| InChIKey | CETAZUFEOUPRCQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decoxy-6-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decoxy-6-methyloxane?
The IUPAC name of 2-decoxy-6-methyloxane (CID 160930984) is 2-decoxy-6-methyloxane.
What is the SMILES notation for 2-decoxy-6-methyloxane?
The canonical SMILES for 2-decoxy-6-methyloxane is CCCCCCCCCCOC1CCCC(C)O1.
What is the InChIKey of 2-decoxy-6-methyloxane?
The InChIKey is CETAZUFEOUPRCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-3-4-5-6-7-8-9-10-14-17-16-13-11-12-15(2)18-16/h15-16H,3-14H2,1-2H3.
What are the key properties of 2-decoxy-6-methyloxane?
2-decoxy-6-methyloxane has a molecular weight of 256.43 g/mol, XLogP of 5.06, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decoxy-6-methyloxane is sourced from PubChem (CID 160930984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).