C11H22O3 — CID 524398
2,6-dipropoxyoxane (PubChem CID 524398) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 2,6-dipropoxyoxane.
| Compound Name | 2,6-dipropoxyoxane |
|---|---|
| PubChem CID | 524398 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2,6-dipropoxyoxane |
| SMILES | CCCOC1CCCC(OCCC)O1 |
| InChI | InChI=1S/C11H22O3/c1-3-8-12-10-6-5-7-11(14-10)13-9-4-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | VFFAGSFTJRWPGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |