C8H16O4 — CID 13108348
(1R)-1-[(2S,6R)-6-methoxyoxan-2-yl]ethane-1,2-diol (PubChem CID 13108348) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1R)-1-[(2S,6R)-6-methoxyoxan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,6R)-6-methoxyoxan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 13108348 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (1R)-1-[(2S,6R)-6-methoxyoxan-2-yl]ethane-1,2-diol |
| SMILES | CO[C@H]1CCC[C@@H]([C@H](O)CO)O1 |
| InChI | InChI=1S/C8H16O4/c1-11-8-4-2-3-7(12-8)6(10)5-9/h6-10H,2-5H2,1H3/t6-,7+,8-/m1/s1 |
| InChIKey | BSUYLXASOVNJCV-GJMOJQLCSA-N |
| XLogP | -0.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |