C13H24O3 — CID 134833646
(2S,6S)-2-methoxy-6-[2-(oxan-2-yl)ethyl]oxane (PubChem CID 134833646) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (2S,6S)-2-methoxy-6-[2-(oxan-2-yl)ethyl]oxane.
| Compound Name | (2S,6S)-2-methoxy-6-[2-(oxan-2-yl)ethyl]oxane |
|---|---|
| PubChem CID | 134833646 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2S,6S)-2-methoxy-6-[2-(oxan-2-yl)ethyl]oxane |
| SMILES | CO[C@@H]1CCC[C@@H](CCC2CCCCO2)O1 |
| InChI | InChI=1S/C13H24O3/c1-14-13-7-4-6-12(16-13)9-8-11-5-2-3-10-15-11/h11-13H,2-10H2,1H3/t11?,12-,13-/m0/s1 |
| InChIKey | YCBWPOXZWOPZGC-SPOOISQMSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |