C9H18O5 — CID 129172685
(1R)-1-[(5R)-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethane-1,2-diol (PubChem CID 129172685) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1R)-1-[(5R)-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(5R)-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 129172685 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (1R)-1-[(5R)-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethane-1,2-diol |
| SMILES | CC(C)(O)O[C@@H]1CCC([C@H](O)CO)O1 |
| InChI | InChI=1S/C9H18O5/c1-9(2,12)14-8-4-3-7(13-8)6(11)5-10/h6-8,10-12H,3-5H2,1-2H3/t6-,7?,8-/m1/s1 |
| InChIKey | RBHPKAVMPFBLFL-OECOWPMFSA-N |
| XLogP | -0.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|