C24H46O6 — CID 11988735
(1S,4S)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-4-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butane-1,4-diol (PubChem CID 11988735) has the molecular formula C24H46O6 and a molecular weight of 430.63 g/mol. Its IUPAC name is (1S,4S)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-4-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butane-1,4-diol.
| Compound Name | (1S,4S)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-4-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butane-1,4-diol |
|---|---|
| PubChem CID | 11988735 |
| Molecular Formula | C24H46O6 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (1S,4S)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-4-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butane-1,4-diol |
| SMILES | CCCCCCCCCC[C@H](O)[C@H]1CC[C@@H]([C@@H](O)CC[C@H](O)[C@@H]2CC[C@H](CO)O2)O1 |
| InChI | InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-19(26)23-15-16-24(30-23)21(28)13-12-20(27)22-14-11-18(17-25)29-22/h18-28H,2-17H2,1H3/t18-,19+,20+,21+,22+,23-,24+/m1/s1 |
| InChIKey | WSQRLONFEVFEMH-HYLAMMOOSA-N |
| XLogP | 3.47 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|