C30H58O4 — CID 11533144
(1S)-1-[(2S,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol (PubChem CID 11533144) has the molecular formula C30H58O4 and a molecular weight of 482.79 g/mol. Its IUPAC name is (1S)-1-[(2S,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol.
| Compound Name | (1S)-1-[(2S,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol |
|---|---|
| PubChem CID | 11533144 |
| Molecular Formula | C30H58O4 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.43 |
| IUPAC Name | (1S)-1-[(2S,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H]([C@H]2CC[C@@H]([C@@H](O)CCCCCCCCCC)O2)O1 |
| InChI | InChI=1S/C30H58O4/c1-3-5-7-9-11-13-15-17-19-25(31)27-21-23-29(33-27)30-24-22-28(34-30)26(32)20-18-16-14-12-10-8-6-4-2/h25-32H,3-24H2,1-2H3/t25-,26+,27-,28+,29+,30- |
| InChIKey | AUCMVFPGZUARCL-WUOBPNQWSA-N |
| XLogP | 7.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|