C22H40O5 — CID 16755942
(1R)-1-[(2R,5R)-5-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]undecan-1-ol (PubChem CID 16755942) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is (1R)-1-[(2R,5R)-5-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]undecan-1-ol.
| Compound Name | (1R)-1-[(2R,5R)-5-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]undecan-1-ol |
|---|---|
| PubChem CID | 16755942 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (1R)-1-[(2R,5R)-5-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]undecan-1-ol |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1CC[C@H]([C@H]2C[C@H]3OC(C)(C)O[C@H]3O2)O1 |
| InChI | InChI=1S/C22H40O5/c1-4-5-6-7-8-9-10-11-12-16(23)17-13-14-18(24-17)19-15-20-21(25-19)27-22(2,3)26-20/h16-21,23H,4-15H2,1-3H3/t16-,17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | UVVJTFNMJWKRMU-UCGFNCKJSA-N |
| XLogP | 4.69 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|